N'-[1-(3-nitrophenyl)ethylidene]-2-{[4-phenyl-5-(3,4,5-trimethoxyphenyl)-4H-1,2,4-triazol-3-yl]sulfanyl}acetohydrazide
Chemical Structure Depiction of
N'-[1-(3-nitrophenyl)ethylidene]-2-{[4-phenyl-5-(3,4,5-trimethoxyphenyl)-4H-1,2,4-triazol-3-yl]sulfanyl}acetohydrazide
N'-[1-(3-nitrophenyl)ethylidene]-2-{[4-phenyl-5-(3,4,5-trimethoxyphenyl)-4H-1,2,4-triazol-3-yl]sulfanyl}acetohydrazide
Compound characteristics
| Compound ID: | 3254-2494 |
| Compound Name: | N'-[1-(3-nitrophenyl)ethylidene]-2-{[4-phenyl-5-(3,4,5-trimethoxyphenyl)-4H-1,2,4-triazol-3-yl]sulfanyl}acetohydrazide |
| Molecular Weight: | 562.6 |
| Molecular Formula: | C27 H26 N6 O6 S |
| Smiles: | C/C(c1cccc(c1)[N+]([O-])=O)=N/NC(CSc1nnc(c2cc(c(c(c2)OC)OC)OC)n1c1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.2781 |
| logD: | 4.2776 |
| logSw: | -4.4279 |
| Hydrogen bond acceptors count: | 13 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 115.734 |
| InChI Key: | FPWQSXOPXUCXQC-UHFFFAOYSA-N |