2-{4-[(2-chlorophenyl)methyl]piperazin-1-yl}-N'-[(3-fluorophenyl)methylidene]acetohydrazide
Chemical Structure Depiction of
2-{4-[(2-chlorophenyl)methyl]piperazin-1-yl}-N'-[(3-fluorophenyl)methylidene]acetohydrazide
2-{4-[(2-chlorophenyl)methyl]piperazin-1-yl}-N'-[(3-fluorophenyl)methylidene]acetohydrazide
Compound characteristics
| Compound ID: | 3254-2673 |
| Compound Name: | 2-{4-[(2-chlorophenyl)methyl]piperazin-1-yl}-N'-[(3-fluorophenyl)methylidene]acetohydrazide |
| Molecular Weight: | 388.87 |
| Molecular Formula: | C20 H22 Cl F N4 O |
| Smiles: | C1CN(CCN1CC(N/N=C/c1cccc(c1)F)=O)Cc1ccccc1[Cl] |
| Stereo: | ACHIRAL |
| logP: | 3.3987 |
| logD: | 3.352 |
| logSw: | -3.6719 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 42.885 |
| InChI Key: | KVKCIXXKFPDRPR-UHFFFAOYSA-N |