N'-[(5-bromo-2-hydroxyphenyl)methylidene]-2-{4-[(2-chlorophenyl)methyl]piperazin-1-yl}acetohydrazide
Chemical Structure Depiction of
N'-[(5-bromo-2-hydroxyphenyl)methylidene]-2-{4-[(2-chlorophenyl)methyl]piperazin-1-yl}acetohydrazide
N'-[(5-bromo-2-hydroxyphenyl)methylidene]-2-{4-[(2-chlorophenyl)methyl]piperazin-1-yl}acetohydrazide
Compound characteristics
| Compound ID: | 3254-2704 |
| Compound Name: | N'-[(5-bromo-2-hydroxyphenyl)methylidene]-2-{4-[(2-chlorophenyl)methyl]piperazin-1-yl}acetohydrazide |
| Molecular Weight: | 465.78 |
| Molecular Formula: | C20 H22 Br Cl N4 O2 |
| Smiles: | C1CN(CCN1CC(N/N=C\c1cc(ccc1O)[Br])=O)Cc1ccccc1[Cl] |
| Stereo: | ACHIRAL |
| logP: | 4.0266 |
| logD: | 3.979 |
| logSw: | -3.9664 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 59.433 |
| InChI Key: | FGTGSQQCBCHLGS-UHFFFAOYSA-N |