N'-[1-(3-methoxyphenyl)ethylidene]-2-methylfuran-3-carbohydrazide
Chemical Structure Depiction of
N'-[1-(3-methoxyphenyl)ethylidene]-2-methylfuran-3-carbohydrazide
N'-[1-(3-methoxyphenyl)ethylidene]-2-methylfuran-3-carbohydrazide
Compound characteristics
| Compound ID: | 3254-3133 |
| Compound Name: | N'-[1-(3-methoxyphenyl)ethylidene]-2-methylfuran-3-carbohydrazide |
| Molecular Weight: | 272.3 |
| Molecular Formula: | C15 H16 N2 O3 |
| Smiles: | C/C(c1cccc(c1)OC)=N/NC(c1ccoc1C)=O |
| Stereo: | ACHIRAL |
| logP: | 2.5541 |
| logD: | 2.5515 |
| logSw: | -3.0094 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 50.619 |
| InChI Key: | BBKCWMNJRRXXKJ-UHFFFAOYSA-N |