N'-[1-(4-fluorophenyl)ethylidene]-2-methylfuran-3-carbohydrazide
Chemical Structure Depiction of
N'-[1-(4-fluorophenyl)ethylidene]-2-methylfuran-3-carbohydrazide
N'-[1-(4-fluorophenyl)ethylidene]-2-methylfuran-3-carbohydrazide
Compound characteristics
| Compound ID: | 3254-3143 |
| Compound Name: | N'-[1-(4-fluorophenyl)ethylidene]-2-methylfuran-3-carbohydrazide |
| Molecular Weight: | 260.27 |
| Molecular Formula: | C14 H13 F N2 O2 |
| Smiles: | C/C(c1ccc(cc1)F)=N/NC(c1ccoc1C)=O |
| Stereo: | ACHIRAL |
| logP: | 2.5112 |
| logD: | 2.5059 |
| logSw: | -2.8701 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 43.075 |
| InChI Key: | BMJVWUPYZMQJSX-UHFFFAOYSA-N |