N'-[1-(2-chlorophenyl)ethylidene]-3-[4-(2-methylpropyl)phenyl]-1H-pyrazole-5-carbohydrazide
Chemical Structure Depiction of
N'-[1-(2-chlorophenyl)ethylidene]-3-[4-(2-methylpropyl)phenyl]-1H-pyrazole-5-carbohydrazide
N'-[1-(2-chlorophenyl)ethylidene]-3-[4-(2-methylpropyl)phenyl]-1H-pyrazole-5-carbohydrazide
Compound characteristics
| Compound ID: | 3254-4475 |
| Compound Name: | N'-[1-(2-chlorophenyl)ethylidene]-3-[4-(2-methylpropyl)phenyl]-1H-pyrazole-5-carbohydrazide |
| Molecular Weight: | 394.9 |
| Molecular Formula: | C22 H23 Cl N4 O |
| Smiles: | CC(C)Cc1ccc(cc1)c1cc(C(N/N=C(\C)c2ccccc2[Cl])=O)[nH]n1 |
| Stereo: | ACHIRAL |
| logP: | 6.1363 |
| logD: | 6.1259 |
| logSw: | -5.878 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 57.332 |
| InChI Key: | PYVYEKAPQAZTLK-UHFFFAOYSA-N |