N-(4-ethoxyphenyl)-2-(4-methylbenzamido)-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide
Chemical Structure Depiction of
N-(4-ethoxyphenyl)-2-(4-methylbenzamido)-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide
N-(4-ethoxyphenyl)-2-(4-methylbenzamido)-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide
Compound characteristics
| Compound ID: | 3261-0227 |
| Compound Name: | N-(4-ethoxyphenyl)-2-(4-methylbenzamido)-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide |
| Molecular Weight: | 420.53 |
| Molecular Formula: | C24 H24 N2 O3 S |
| Smiles: | CCOc1ccc(cc1)NC(c1c2CCCc2sc1NC(c1ccc(C)cc1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.4239 |
| logD: | 4.2053 |
| logSw: | -5.3964 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 53.625 |
| InChI Key: | OZPJCRRBXXKDGZ-UHFFFAOYSA-N |