N-(2-methoxyphenyl)-2-(4-methylbenzamido)benzamide
Chemical Structure Depiction of
N-(2-methoxyphenyl)-2-(4-methylbenzamido)benzamide
N-(2-methoxyphenyl)-2-(4-methylbenzamido)benzamide
Compound characteristics
| Compound ID: | 3261-0369 |
| Compound Name: | N-(2-methoxyphenyl)-2-(4-methylbenzamido)benzamide |
| Molecular Weight: | 360.41 |
| Molecular Formula: | C22 H20 N2 O3 |
| Smiles: | Cc1ccc(cc1)C(Nc1ccccc1C(Nc1ccccc1OC)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.1549 |
| logD: | 4.1531 |
| logSw: | -4.3782 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 52.656 |
| InChI Key: | TWBHLWNGYGZMPX-UHFFFAOYSA-N |