6-methyl-N-(2-methylphenyl)-2-(2-phenylacetamido)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide
Chemical Structure Depiction of
6-methyl-N-(2-methylphenyl)-2-(2-phenylacetamido)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide
6-methyl-N-(2-methylphenyl)-2-(2-phenylacetamido)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide
Compound characteristics
| Compound ID: | 3261-0453 |
| Compound Name: | 6-methyl-N-(2-methylphenyl)-2-(2-phenylacetamido)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| Molecular Weight: | 418.56 |
| Molecular Formula: | C25 H26 N2 O2 S |
| Smiles: | CC1CCc2c(C(Nc3ccccc3C)=O)c(NC(Cc3ccccc3)=O)sc2C1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.3309 |
| logD: | 4.9277 |
| logSw: | -5.3459 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 45.224 |
| InChI Key: | DNWXOUGRDWOGOC-MRXNPFEDSA-N |