N-(2-ethoxyphenyl)-2-(4-methylbenzamido)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxamide
Chemical Structure Depiction of
N-(2-ethoxyphenyl)-2-(4-methylbenzamido)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxamide
N-(2-ethoxyphenyl)-2-(4-methylbenzamido)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxamide
Compound characteristics
| Compound ID: | 3261-1050 |
| Compound Name: | N-(2-ethoxyphenyl)-2-(4-methylbenzamido)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxamide |
| Molecular Weight: | 448.58 |
| Molecular Formula: | C26 H28 N2 O3 S |
| Smiles: | CCOc1ccccc1NC(c1c2CCCCCc2sc1NC(c1ccc(C)cc1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 6.334 |
| logD: | 5.1348 |
| logSw: | -5.4936 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 52.979 |
| InChI Key: | JPQMVDYDCQQGCN-UHFFFAOYSA-N |