5-{[4-(benzyloxy)-3-bromo-5-ethoxyphenyl]methylidene}-1-(4-tert-butylphenyl)-1,3-diazinane-2,4,6-trione
Chemical Structure Depiction of
5-{[4-(benzyloxy)-3-bromo-5-ethoxyphenyl]methylidene}-1-(4-tert-butylphenyl)-1,3-diazinane-2,4,6-trione
5-{[4-(benzyloxy)-3-bromo-5-ethoxyphenyl]methylidene}-1-(4-tert-butylphenyl)-1,3-diazinane-2,4,6-trione
Compound characteristics
| Compound ID: | 3269-0480 |
| Compound Name: | 5-{[4-(benzyloxy)-3-bromo-5-ethoxyphenyl]methylidene}-1-(4-tert-butylphenyl)-1,3-diazinane-2,4,6-trione |
| Molecular Weight: | 577.48 |
| Molecular Formula: | C30 H29 Br N2 O5 |
| Smiles: | CCOc1cc(\C=C2/C(NC(N(C2=O)c2ccc(cc2)C(C)(C)C)=O)=O)cc(c1OCc1ccccc1)[Br] |
| Stereo: | ACHIRAL |
| logP: | 6.5537 |
| logD: | 6.2507 |
| logSw: | -5.6843 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 68.002 |
| InChI Key: | DGPLFKUKYTVAMQ-UHFFFAOYSA-N |