2,2,3,3-tetramethyl-N-(3-nitrophenyl)cyclopropane-1-carboxamide
Chemical Structure Depiction of
2,2,3,3-tetramethyl-N-(3-nitrophenyl)cyclopropane-1-carboxamide
2,2,3,3-tetramethyl-N-(3-nitrophenyl)cyclopropane-1-carboxamide
Compound characteristics
| Compound ID: | 3271-0412 |
| Compound Name: | 2,2,3,3-tetramethyl-N-(3-nitrophenyl)cyclopropane-1-carboxamide |
| Molecular Weight: | 262.31 |
| Molecular Formula: | C14 H18 N2 O3 |
| Smiles: | CC1(C)C(C(Nc2cccc(c2)[N+]([O-])=O)=O)C1(C)C |
| Stereo: | ACHIRAL |
| logP: | 3.5388 |
| logD: | 3.5336 |
| logSw: | -3.6505 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 57.234 |
| InChI Key: | AOTRNHJANWOAIO-UHFFFAOYSA-N |