2,2-bis(3-methylphenyl)-N-[3-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide
Chemical Structure Depiction of
2,2-bis(3-methylphenyl)-N-[3-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide
2,2-bis(3-methylphenyl)-N-[3-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide
Compound characteristics
| Compound ID: | 3271-0416 |
| Compound Name: | 2,2-bis(3-methylphenyl)-N-[3-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide |
| Molecular Weight: | 409.45 |
| Molecular Formula: | C25 H22 F3 N O |
| Smiles: | Cc1cccc(c1)C1(CC1C(Nc1cccc(c1)C(F)(F)F)=O)c1cccc(C)c1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.8396 |
| logD: | 6.43 |
| logSw: | -5.7359 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 23.3097 |
| InChI Key: | PJCSTJNURSHXSN-JOCHJYFZSA-N |