N-{2-[2-(4-tert-butylcyclohexylidene)hydrazinyl]-2-oxoethyl}-N-(3-methylphenyl)benzenesulfonamide
Chemical Structure Depiction of
N-{2-[2-(4-tert-butylcyclohexylidene)hydrazinyl]-2-oxoethyl}-N-(3-methylphenyl)benzenesulfonamide
N-{2-[2-(4-tert-butylcyclohexylidene)hydrazinyl]-2-oxoethyl}-N-(3-methylphenyl)benzenesulfonamide
Compound characteristics
| Compound ID: | 3272-0011 |
| Compound Name: | N-{2-[2-(4-tert-butylcyclohexylidene)hydrazinyl]-2-oxoethyl}-N-(3-methylphenyl)benzenesulfonamide |
| Molecular Weight: | 455.62 |
| Molecular Formula: | C25 H33 N3 O3 S |
| Smiles: | Cc1cccc(c1)N(CC(NN=C1CCC(CC1)C(C)(C)C)=O)S(c1ccccc1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.2766 |
| logD: | 5.2765 |
| logSw: | -5.1364 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 67.395 |
| InChI Key: | AZHPVBPHTSYEQJ-UHFFFAOYSA-N |