N-(4-methoxyphenyl)-N-(2-{2-[(2-methoxyphenyl)methylidene]hydrazinyl}-2-oxoethyl)benzenesulfonamide
Chemical Structure Depiction of
N-(4-methoxyphenyl)-N-(2-{2-[(2-methoxyphenyl)methylidene]hydrazinyl}-2-oxoethyl)benzenesulfonamide
N-(4-methoxyphenyl)-N-(2-{2-[(2-methoxyphenyl)methylidene]hydrazinyl}-2-oxoethyl)benzenesulfonamide
Compound characteristics
| Compound ID: | 3272-0089 |
| Compound Name: | N-(4-methoxyphenyl)-N-(2-{2-[(2-methoxyphenyl)methylidene]hydrazinyl}-2-oxoethyl)benzenesulfonamide |
| Molecular Weight: | 453.52 |
| Molecular Formula: | C23 H23 N3 O5 S |
| Smiles: | COc1ccc(cc1)N(CC(N/N=C/c1ccccc1OC)=O)S(c1ccccc1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.8489 |
| logD: | 3.8488 |
| logSw: | -4.1114 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 82.34 |
| InChI Key: | SWRSVGQUNPLKDV-UHFFFAOYSA-N |