2-[(pyrimidin-2-yl)sulfanyl]-N'-[(2,3,4-trimethylphenyl)methylidene]acetohydrazide
Chemical Structure Depiction of
2-[(pyrimidin-2-yl)sulfanyl]-N'-[(2,3,4-trimethylphenyl)methylidene]acetohydrazide
2-[(pyrimidin-2-yl)sulfanyl]-N'-[(2,3,4-trimethylphenyl)methylidene]acetohydrazide
Compound characteristics
| Compound ID: | 3272-0528 |
| Compound Name: | 2-[(pyrimidin-2-yl)sulfanyl]-N'-[(2,3,4-trimethylphenyl)methylidene]acetohydrazide |
| Molecular Weight: | 314.41 |
| Molecular Formula: | C16 H18 N4 O S |
| Smiles: | Cc1ccc(/C=N/NC(CSc2ncccn2)=O)c(C)c1C |
| Stereo: | ACHIRAL |
| logP: | 3.4478 |
| logD: | 3.4477 |
| logSw: | -3.6179 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 53.498 |
| InChI Key: | LSGZQDMUAJQNCI-UHFFFAOYSA-N |