N-phenyl-N-[(4-{2-[(pyridin-4-yl)methylidene]hydrazinecarbonyl}phenyl)methyl]methanesulfonamide
Chemical Structure Depiction of
N-phenyl-N-[(4-{2-[(pyridin-4-yl)methylidene]hydrazinecarbonyl}phenyl)methyl]methanesulfonamide
N-phenyl-N-[(4-{2-[(pyridin-4-yl)methylidene]hydrazinecarbonyl}phenyl)methyl]methanesulfonamide
Compound characteristics
| Compound ID: | 3272-0657 |
| Compound Name: | N-phenyl-N-[(4-{2-[(pyridin-4-yl)methylidene]hydrazinecarbonyl}phenyl)methyl]methanesulfonamide |
| Molecular Weight: | 408.48 |
| Molecular Formula: | C21 H20 N4 O3 S |
| Smiles: | CS(N(Cc1ccc(cc1)C(N/N=C/c1ccncc1)=O)c1ccccc1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.3499 |
| logD: | 2.3408 |
| logSw: | -2.7199 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 76.3 |
| InChI Key: | BBUKAHMQFQCQBD-UHFFFAOYSA-N |