3-chloro-N-{3-[1-(2-{4-[(morpholin-4-yl)methyl]benzoyl}hydrazinylidene)ethyl]phenyl}benzamide
Chemical Structure Depiction of
3-chloro-N-{3-[1-(2-{4-[(morpholin-4-yl)methyl]benzoyl}hydrazinylidene)ethyl]phenyl}benzamide
3-chloro-N-{3-[1-(2-{4-[(morpholin-4-yl)methyl]benzoyl}hydrazinylidene)ethyl]phenyl}benzamide
Compound characteristics
| Compound ID: | 3272-0721 |
| Compound Name: | 3-chloro-N-{3-[1-(2-{4-[(morpholin-4-yl)methyl]benzoyl}hydrazinylidene)ethyl]phenyl}benzamide |
| Molecular Weight: | 490.99 |
| Molecular Formula: | C27 H27 Cl N4 O3 |
| Smiles: | C\C(c1cccc(c1)NC(c1cccc(c1)[Cl])=O)=N/NC(c1ccc(CN2CCOCC2)cc1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.3752 |
| logD: | 4.3054 |
| logSw: | -4.4722 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 69.574 |
| InChI Key: | PRTCADPGZGBSTG-UHFFFAOYSA-N |