N'-[(3-ethoxy-4-hydroxyphenyl)methylidene]-3-(phenylsulfanyl)propanehydrazide
					Chemical Structure Depiction of
N'-[(3-ethoxy-4-hydroxyphenyl)methylidene]-3-(phenylsulfanyl)propanehydrazide
			N'-[(3-ethoxy-4-hydroxyphenyl)methylidene]-3-(phenylsulfanyl)propanehydrazide
Compound characteristics
| Compound ID: | 3272-0873 | 
| Compound Name: | N'-[(3-ethoxy-4-hydroxyphenyl)methylidene]-3-(phenylsulfanyl)propanehydrazide | 
| Molecular Weight: | 344.43 | 
| Molecular Formula: | C18 H20 N2 O3 S | 
| Smiles: | CCOc1cc(/C=N/NC(CCSc2ccccc2)=O)ccc1O | 
| Stereo: | ACHIRAL | 
| logP: | 3.3426 | 
| logD: | 3.341 | 
| logSw: | -3.3454 | 
| Hydrogen bond acceptors count: | 6 | 
| Hydrogen bond donors count: | 2 | 
| Polar surface area: | 59.099 | 
| InChI Key: | PJEQWILUYFLUOW-UHFFFAOYSA-N | 
 
				 
				