N-(4-{2-[(2-hydroxy-3-methoxyphenyl)methylidene]hydrazinecarbonyl}phenyl)-N-methylbenzenesulfonamide
Chemical Structure Depiction of
N-(4-{2-[(2-hydroxy-3-methoxyphenyl)methylidene]hydrazinecarbonyl}phenyl)-N-methylbenzenesulfonamide
N-(4-{2-[(2-hydroxy-3-methoxyphenyl)methylidene]hydrazinecarbonyl}phenyl)-N-methylbenzenesulfonamide
Compound characteristics
| Compound ID: | 3272-0917 |
| Compound Name: | N-(4-{2-[(2-hydroxy-3-methoxyphenyl)methylidene]hydrazinecarbonyl}phenyl)-N-methylbenzenesulfonamide |
| Molecular Weight: | 439.49 |
| Molecular Formula: | C22 H21 N3 O5 S |
| Smiles: | CN(c1ccc(cc1)C(N/N=C/c1cccc(c1O)OC)=O)S(c1ccccc1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.8213 |
| logD: | 3.8127 |
| logSw: | -4.0942 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 91.485 |
| InChI Key: | DAIAOUPKWXZKBV-UHFFFAOYSA-N |