4-{[(benzenesulfonyl)(5-chloro-2-methylphenyl)amino]methyl}-N,N-diethylbenzamide
Chemical Structure Depiction of
4-{[(benzenesulfonyl)(5-chloro-2-methylphenyl)amino]methyl}-N,N-diethylbenzamide
4-{[(benzenesulfonyl)(5-chloro-2-methylphenyl)amino]methyl}-N,N-diethylbenzamide
Compound characteristics
| Compound ID: | 3272-1414 |
| Compound Name: | 4-{[(benzenesulfonyl)(5-chloro-2-methylphenyl)amino]methyl}-N,N-diethylbenzamide |
| Molecular Weight: | 471.02 |
| Molecular Formula: | C25 H27 Cl N2 O3 S |
| Smiles: | CCN(CC)C(c1ccc(CN(c2cc(ccc2C)[Cl])S(c2ccccc2)(=O)=O)cc1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.9266 |
| logD: | 4.9266 |
| logSw: | -5.0013 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 47.423 |
| InChI Key: | KABDEELUEMVQAY-UHFFFAOYSA-N |