N'-[(3-chlorophenyl)methylidene]-2-(4-ethoxyanilino)propanehydrazide
Chemical Structure Depiction of
N'-[(3-chlorophenyl)methylidene]-2-(4-ethoxyanilino)propanehydrazide
N'-[(3-chlorophenyl)methylidene]-2-(4-ethoxyanilino)propanehydrazide
Compound characteristics
| Compound ID: | 3284-0058 |
| Compound Name: | N'-[(3-chlorophenyl)methylidene]-2-(4-ethoxyanilino)propanehydrazide |
| Molecular Weight: | 345.83 |
| Molecular Formula: | C18 H20 Cl N3 O2 |
| Smiles: | CCOc1ccc(cc1)NC(C)C(N/N=C/c1cccc(c1)[Cl])=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.4363 |
| logD: | 4.4317 |
| logSw: | -4.4552 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 52.347 |
| InChI Key: | IPYVEPZYQUWFJS-ZDUSSCGKSA-N |