2-(2-methoxyanilino)-N'-[(5-methylfuran-2-yl)methylidene]propanehydrazide
Chemical Structure Depiction of
2-(2-methoxyanilino)-N'-[(5-methylfuran-2-yl)methylidene]propanehydrazide
2-(2-methoxyanilino)-N'-[(5-methylfuran-2-yl)methylidene]propanehydrazide
Compound characteristics
| Compound ID: | 3284-0173 |
| Compound Name: | 2-(2-methoxyanilino)-N'-[(5-methylfuran-2-yl)methylidene]propanehydrazide |
| Molecular Weight: | 301.34 |
| Molecular Formula: | C16 H19 N3 O3 |
| Smiles: | CC(C(N/N=C/c1ccc(C)o1)=O)Nc1ccccc1OC |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.2775 |
| logD: | 3.2771 |
| logSw: | -3.6059 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 59.419 |
| InChI Key: | XVWVGCCJCZNDTD-LBPRGKRZSA-N |