N'-[(6-methylpyridin-2-yl)methylidene]-2-[(naphthalen-1-yl)amino]propanehydrazide
Chemical Structure Depiction of
N'-[(6-methylpyridin-2-yl)methylidene]-2-[(naphthalen-1-yl)amino]propanehydrazide
N'-[(6-methylpyridin-2-yl)methylidene]-2-[(naphthalen-1-yl)amino]propanehydrazide
Compound characteristics
| Compound ID: | 3284-0385 |
| Compound Name: | N'-[(6-methylpyridin-2-yl)methylidene]-2-[(naphthalen-1-yl)amino]propanehydrazide |
| Molecular Weight: | 332.4 |
| Molecular Formula: | C20 H20 N4 O |
| Smiles: | CC(C(N/N=C/c1cccc(C)n1)=O)Nc1cccc2ccccc12 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.7342 |
| logD: | 3.6564 |
| logSw: | -3.9009 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 53.172 |
| InChI Key: | SOAGHVVXWUSYSB-HNNXBMFYSA-N |