5-bromo-2-ethoxy-N'-[(3-methoxyphenyl)methylidene]benzohydrazide
Chemical Structure Depiction of
5-bromo-2-ethoxy-N'-[(3-methoxyphenyl)methylidene]benzohydrazide
5-bromo-2-ethoxy-N'-[(3-methoxyphenyl)methylidene]benzohydrazide
Compound characteristics
| Compound ID: | 3284-0395 |
| Compound Name: | 5-bromo-2-ethoxy-N'-[(3-methoxyphenyl)methylidene]benzohydrazide |
| Molecular Weight: | 377.24 |
| Molecular Formula: | C17 H17 Br N2 O3 |
| Smiles: | CCOc1ccc(cc1C(N/N=C/c1cccc(c1)OC)=O)[Br] |
| Stereo: | ACHIRAL |
| logP: | 4.2547 |
| logD: | 3.8611 |
| logSw: | -4.328 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 50.308 |
| InChI Key: | QGEMTYCUCFSBNH-UHFFFAOYSA-N |