N'-[(2-methoxyphenyl)methylidene]-2-[(naphthalen-1-yl)amino]propanehydrazide
Chemical Structure Depiction of
N'-[(2-methoxyphenyl)methylidene]-2-[(naphthalen-1-yl)amino]propanehydrazide
N'-[(2-methoxyphenyl)methylidene]-2-[(naphthalen-1-yl)amino]propanehydrazide
Compound characteristics
| Compound ID: | 3284-0683 |
| Compound Name: | N'-[(2-methoxyphenyl)methylidene]-2-[(naphthalen-1-yl)amino]propanehydrazide |
| Molecular Weight: | 347.42 |
| Molecular Formula: | C21 H21 N3 O2 |
| Smiles: | CC(C(N/N=C/c1ccccc1OC)=O)Nc1cccc2ccccc12 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.6848 |
| logD: | 4.6847 |
| logSw: | -5.1281 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 51.884 |
| InChI Key: | MWUIJNJPPCFUNA-HNNXBMFYSA-N |