2-(2-methoxyanilino)-N'-[(3-phenoxyphenyl)methylidene]propanehydrazide
Chemical Structure Depiction of
2-(2-methoxyanilino)-N'-[(3-phenoxyphenyl)methylidene]propanehydrazide
2-(2-methoxyanilino)-N'-[(3-phenoxyphenyl)methylidene]propanehydrazide
Compound characteristics
| Compound ID: | 3284-1372 |
| Compound Name: | 2-(2-methoxyanilino)-N'-[(3-phenoxyphenyl)methylidene]propanehydrazide |
| Molecular Weight: | 389.45 |
| Molecular Formula: | C23 H23 N3 O3 |
| Smiles: | CC(C(N/N=C/c1cccc(c1)Oc1ccccc1)=O)Nc1ccccc1OC |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.9566 |
| logD: | 4.9559 |
| logSw: | -4.6779 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 58.904 |
| InChI Key: | MVWQKWGNOBWMNH-KRWDZBQOSA-N |