2-(4-chloroanilino)-N'-[1-(4-methoxyphenyl)ethylidene]propanehydrazide
Chemical Structure Depiction of
2-(4-chloroanilino)-N'-[1-(4-methoxyphenyl)ethylidene]propanehydrazide
2-(4-chloroanilino)-N'-[1-(4-methoxyphenyl)ethylidene]propanehydrazide
Compound characteristics
| Compound ID: | 3284-1749 |
| Compound Name: | 2-(4-chloroanilino)-N'-[1-(4-methoxyphenyl)ethylidene]propanehydrazide |
| Molecular Weight: | 345.83 |
| Molecular Formula: | C18 H20 Cl N3 O2 |
| Smiles: | CC(C(N/N=C(\C)c1ccc(cc1)OC)=O)Nc1ccc(cc1)[Cl] |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.072 |
| logD: | 4.0711 |
| logSw: | -4.5268 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 52.055 |
| InChI Key: | NOEBSXXEZVZELL-ZDUSSCGKSA-N |