4-{[3-(tert-butylcarbamoyl)phenyl]carbamoyl}phenyl acetate
Chemical Structure Depiction of
4-{[3-(tert-butylcarbamoyl)phenyl]carbamoyl}phenyl acetate
4-{[3-(tert-butylcarbamoyl)phenyl]carbamoyl}phenyl acetate
Compound characteristics
| Compound ID: | 3289-8654 |
| Compound Name: | 4-{[3-(tert-butylcarbamoyl)phenyl]carbamoyl}phenyl acetate |
| Molecular Weight: | 354.4 |
| Molecular Formula: | C20 H22 N2 O4 |
| Smiles: | CC(=O)Oc1ccc(cc1)C(Nc1cccc(c1)C(NC(C)(C)C)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.0707 |
| logD: | 3.0706 |
| logSw: | -3.4859 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 67.589 |
| InChI Key: | LOXVWIQDQQXLKB-UHFFFAOYSA-N |