5-{[4-(dimethylamino)phenyl]methylidene}-2-(2,3-dimethylanilino)-1,3-thiazol-4(5H)-one
Chemical Structure Depiction of
5-{[4-(dimethylamino)phenyl]methylidene}-2-(2,3-dimethylanilino)-1,3-thiazol-4(5H)-one
5-{[4-(dimethylamino)phenyl]methylidene}-2-(2,3-dimethylanilino)-1,3-thiazol-4(5H)-one
Compound characteristics
| Compound ID: | 3324-0186 |
| Compound Name: | 5-{[4-(dimethylamino)phenyl]methylidene}-2-(2,3-dimethylanilino)-1,3-thiazol-4(5H)-one |
| Molecular Weight: | 351.47 |
| Molecular Formula: | C20 H21 N3 O S |
| Smiles: | Cc1cccc(c1C)NC1=NC(/C(=C/c2ccc(cc2)N(C)C)S1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.7341 |
| logD: | 4.7339 |
| logSw: | -4.409 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 33.731 |
| InChI Key: | KSJOYRGWVOCRNO-UHFFFAOYSA-N |