N-(4-acetylphenyl)-4-(3,5-dimethylpiperidine-1-sulfonyl)benzamide
Chemical Structure Depiction of
N-(4-acetylphenyl)-4-(3,5-dimethylpiperidine-1-sulfonyl)benzamide
N-(4-acetylphenyl)-4-(3,5-dimethylpiperidine-1-sulfonyl)benzamide
Compound characteristics
| Compound ID: | 3330-0346 |
| Compound Name: | N-(4-acetylphenyl)-4-(3,5-dimethylpiperidine-1-sulfonyl)benzamide |
| Molecular Weight: | 414.52 |
| Molecular Formula: | C22 H26 N2 O4 S |
| Smiles: | CC1CC(C)CN(C1)S(c1ccc(cc1)C(Nc1ccc(cc1)C(C)=O)=O)(=O)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 3.6195 |
| logD: | 3.5936 |
| logSw: | -3.837 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 68.734 |
| InChI Key: | PGMLRMSDHDHYOG-UHFFFAOYSA-N |