7-methyl-4-(4-nitrophenyl)quinolin-2(1H)-one
Chemical Structure Depiction of
7-methyl-4-(4-nitrophenyl)quinolin-2(1H)-one
7-methyl-4-(4-nitrophenyl)quinolin-2(1H)-one
Compound characteristics
| Compound ID: | 3334-4823 |
| Compound Name: | 7-methyl-4-(4-nitrophenyl)quinolin-2(1H)-one |
| Molecular Weight: | 280.28 |
| Molecular Formula: | C16 H12 N2 O3 |
| Smiles: | Cc1ccc2C(=CC(Nc2c1)=O)c1ccc(cc1)[N+]([O-])=O |
| Stereo: | ACHIRAL |
| logP: | 2.9967 |
| logD: | 2.9967 |
| logSw: | -3.5724 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 58.169 |
| InChI Key: | AIPRYILPOZTXBV-UHFFFAOYSA-N |