2-chloro-N-[3-(imidazo[1,2-a]pyridin-2-yl)phenyl]benzamide
Chemical Structure Depiction of
2-chloro-N-[3-(imidazo[1,2-a]pyridin-2-yl)phenyl]benzamide
2-chloro-N-[3-(imidazo[1,2-a]pyridin-2-yl)phenyl]benzamide
Compound characteristics
| Compound ID: | 3336-2646 |
| Compound Name: | 2-chloro-N-[3-(imidazo[1,2-a]pyridin-2-yl)phenyl]benzamide |
| Molecular Weight: | 347.8 |
| Molecular Formula: | C20 H14 Cl N3 O |
| Smiles: | c1ccc(c(c1)C(Nc1cccc(c1)c1cn2ccccc2n1)=O)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 4.6824 |
| logD: | 4.6797 |
| logSw: | -4.9568 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 32.725 |
| InChI Key: | CIEORAGFBOJRMX-UHFFFAOYSA-N |