(isoquinolin-1-yl)(phenyl)methyl 4-fluorobenzoate
Chemical Structure Depiction of
(isoquinolin-1-yl)(phenyl)methyl 4-fluorobenzoate
(isoquinolin-1-yl)(phenyl)methyl 4-fluorobenzoate
Compound characteristics
| Compound ID: | 3341-3815 |
| Compound Name: | (isoquinolin-1-yl)(phenyl)methyl 4-fluorobenzoate |
| Molecular Weight: | 357.38 |
| Molecular Formula: | C23 H16 F N O2 |
| Smiles: | c1ccc(cc1)C(c1c2ccccc2ccn1)OC(c1ccc(cc1)F)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.6825 |
| logD: | 5.6825 |
| logSw: | -6.7359 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 29.6476 |
| InChI Key: | NNLXVACXPGZSAB-QFIPXVFZSA-N |