ethyl 6-bromo-2-methyl-5-[(4-methylphenyl)methoxy]-1-benzofuran-3-carboxylate
Chemical Structure Depiction of
ethyl 6-bromo-2-methyl-5-[(4-methylphenyl)methoxy]-1-benzofuran-3-carboxylate
ethyl 6-bromo-2-methyl-5-[(4-methylphenyl)methoxy]-1-benzofuran-3-carboxylate
Compound characteristics
| Compound ID: | 3341-4983 |
| Compound Name: | ethyl 6-bromo-2-methyl-5-[(4-methylphenyl)methoxy]-1-benzofuran-3-carboxylate |
| Molecular Weight: | 403.27 |
| Molecular Formula: | C20 H19 Br O4 |
| Smiles: | CCOC(c1c2cc(c(cc2oc1C)[Br])OCc1ccc(C)cc1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.5643 |
| logD: | 5.5643 |
| logSw: | -5.5998 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 36.254 |
| InChI Key: | VBZJYMVIOUBGOC-UHFFFAOYSA-N |