2,2'-[methylenedi(4,1-phenylene)]di(3a,4,7,7a-tetrahydro-1H-4,7-methanoisoindole-1,3(2H)-dione)
Chemical Structure Depiction of
2,2'-[methylenedi(4,1-phenylene)]di(3a,4,7,7a-tetrahydro-1H-4,7-methanoisoindole-1,3(2H)-dione)
2,2'-[methylenedi(4,1-phenylene)]di(3a,4,7,7a-tetrahydro-1H-4,7-methanoisoindole-1,3(2H)-dione)
Compound characteristics
| Compound ID: | 3342-1017 |
| Compound Name: | 2,2'-[methylenedi(4,1-phenylene)]di(3a,4,7,7a-tetrahydro-1H-4,7-methanoisoindole-1,3(2H)-dione) |
| Molecular Weight: | 490.56 |
| Molecular Formula: | C31 H26 N2 O4 |
| Smiles: | C1C2C=CC1C1C2C(N(C1=O)c1ccc(Cc2ccc(cc2)N2C(C3C4CC(C=C4)C3C2=O)=O)cc1)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 2.6877 |
| logD: | 2.6877 |
| logSw: | -2.8502 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 58.939 |
| InChI Key: | LTSYMGSWVPHCEO-UHFFFAOYSA-N |