1-ethyl-6-methoxyquinoline-2(1H)-thione
Chemical Structure Depiction of
1-ethyl-6-methoxyquinoline-2(1H)-thione
1-ethyl-6-methoxyquinoline-2(1H)-thione
Compound characteristics
| Compound ID: | 3343-3679 |
| Compound Name: | 1-ethyl-6-methoxyquinoline-2(1H)-thione |
| Molecular Weight: | 219.3 |
| Molecular Formula: | C12 H13 N O S |
| Smiles: | CCN1C(C=Cc2cc(ccc12)OC)=S |
| Stereo: | ACHIRAL |
| logP: | 3.2628 |
| logD: | 3.2628 |
| logSw: | -3.5138 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 9.8305 |
| InChI Key: | XTCNECLGISWWCO-UHFFFAOYSA-N |