ethyl 4-(4-methylphenyl)-2-{[2-(4-propoxyphenyl)quinoline-4-carbonyl]amino}thiophene-3-carboxylate
Chemical Structure Depiction of
ethyl 4-(4-methylphenyl)-2-{[2-(4-propoxyphenyl)quinoline-4-carbonyl]amino}thiophene-3-carboxylate
ethyl 4-(4-methylphenyl)-2-{[2-(4-propoxyphenyl)quinoline-4-carbonyl]amino}thiophene-3-carboxylate
Compound characteristics
| Compound ID: | 3360-9535 |
| Compound Name: | ethyl 4-(4-methylphenyl)-2-{[2-(4-propoxyphenyl)quinoline-4-carbonyl]amino}thiophene-3-carboxylate |
| Molecular Weight: | 550.68 |
| Molecular Formula: | C33 H30 N2 O4 S |
| Smiles: | CCCOc1ccc(cc1)c1cc(C(Nc2c(C(=O)OCC)c(cs2)c2ccc(C)cc2)=O)c2ccccc2n1 |
| Stereo: | ACHIRAL |
| logP: | 8.584 |
| logD: | 8.5751 |
| logSw: | -5.9459 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 59.083 |
| InChI Key: | VTFOCGQRLYEAQR-UHFFFAOYSA-N |