[2-(4-methylphenyl)quinolin-4-yl][4-(3-phenylprop-2-en-1-yl)piperazin-1-yl]methanone
Chemical Structure Depiction of
[2-(4-methylphenyl)quinolin-4-yl][4-(3-phenylprop-2-en-1-yl)piperazin-1-yl]methanone
[2-(4-methylphenyl)quinolin-4-yl][4-(3-phenylprop-2-en-1-yl)piperazin-1-yl]methanone
Compound characteristics
| Compound ID: | 3365-3272 |
| Compound Name: | [2-(4-methylphenyl)quinolin-4-yl][4-(3-phenylprop-2-en-1-yl)piperazin-1-yl]methanone |
| Molecular Weight: | 447.58 |
| Molecular Formula: | C30 H29 N3 O |
| Smiles: | Cc1ccc(cc1)c1cc(C(N2CCN(CC2)C/C=C/c2ccccc2)=O)c2ccccc2n1 |
| Stereo: | ACHIRAL |
| logP: | 6.319 |
| logD: | 6.3172 |
| logSw: | -5.7058 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 28.4647 |
| InChI Key: | SCTQJVXGCFVDMU-UHFFFAOYSA-N |