[2-(2,4-dichlorophenyl)-3-methylquinolin-4-yl](4-phenylpiperazin-1-yl)methanone
Chemical Structure Depiction of
[2-(2,4-dichlorophenyl)-3-methylquinolin-4-yl](4-phenylpiperazin-1-yl)methanone
[2-(2,4-dichlorophenyl)-3-methylquinolin-4-yl](4-phenylpiperazin-1-yl)methanone
Compound characteristics
| Compound ID: | 3366-4216 |
| Compound Name: | [2-(2,4-dichlorophenyl)-3-methylquinolin-4-yl](4-phenylpiperazin-1-yl)methanone |
| Molecular Weight: | 476.4 |
| Molecular Formula: | C27 H23 Cl2 N3 O |
| Smiles: | Cc1c(C(N2CCN(CC2)c2ccccc2)=O)c2ccccc2nc1c1ccc(cc1[Cl])[Cl] |
| Stereo: | ACHIRAL |
| logP: | 6.4797 |
| logD: | 6.4792 |
| logSw: | -6.3171 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 28.9767 |
| InChI Key: | MTSXKYSECUKZPX-UHFFFAOYSA-N |