3,5-diethoxy-N-[6-methyl-2-(4-methylphenyl)-2H-benzotriazol-5-yl]benzamide
Chemical Structure Depiction of
3,5-diethoxy-N-[6-methyl-2-(4-methylphenyl)-2H-benzotriazol-5-yl]benzamide
3,5-diethoxy-N-[6-methyl-2-(4-methylphenyl)-2H-benzotriazol-5-yl]benzamide
Compound characteristics
| Compound ID: | 3370-3674 |
| Compound Name: | 3,5-diethoxy-N-[6-methyl-2-(4-methylphenyl)-2H-benzotriazol-5-yl]benzamide |
| Molecular Weight: | 430.51 |
| Molecular Formula: | C25 H26 N4 O3 |
| Smiles: | CCOc1cc(cc(c1)OCC)C(Nc1cc2c(cc1C)nn(c1ccc(C)cc1)n2)=O |
| Stereo: | ACHIRAL |
| logP: | 5.6294 |
| logD: | 5.6278 |
| logSw: | -5.3138 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 60.913 |
| InChI Key: | AURLFFQHEMCTGE-UHFFFAOYSA-N |