N-{3-(4-chlorophenyl)-2-[(furan-2-carbonyl)amino]prop-2-enoyl}methionine
Chemical Structure Depiction of
N-{3-(4-chlorophenyl)-2-[(furan-2-carbonyl)amino]prop-2-enoyl}methionine
N-{3-(4-chlorophenyl)-2-[(furan-2-carbonyl)amino]prop-2-enoyl}methionine
Compound characteristics
| Compound ID: | 3379-2683 |
| Compound Name: | N-{3-(4-chlorophenyl)-2-[(furan-2-carbonyl)amino]prop-2-enoyl}methionine |
| Molecular Weight: | 422.89 |
| Molecular Formula: | C19 H19 Cl N2 O5 S |
| Smiles: | CSCCC(C(O)=O)NC(/C(=C/c1ccc(cc1)[Cl])NC(c1ccco1)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.8815 |
| logD: | -1.4854 |
| logSw: | -2.881 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 83.465 |
| InChI Key: | JZNHBMVRHOSNRJ-AWEZNQCLSA-N |