N-[2-benzamido-3-(4-chlorophenyl)prop-2-enoyl]phenylalanine
Chemical Structure Depiction of
N-[2-benzamido-3-(4-chlorophenyl)prop-2-enoyl]phenylalanine
N-[2-benzamido-3-(4-chlorophenyl)prop-2-enoyl]phenylalanine
Compound characteristics
| Compound ID: | 3379-2713 |
| Compound Name: | N-[2-benzamido-3-(4-chlorophenyl)prop-2-enoyl]phenylalanine |
| Molecular Weight: | 448.91 |
| Molecular Formula: | C25 H21 Cl N2 O4 |
| Smiles: | C(C(C(O)=O)NC(/C(=C/c1ccc(cc1)[Cl])NC(c1ccccc1)=O)=O)c1ccccc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.1411 |
| logD: | -0.1985 |
| logSw: | -3.6129 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 74.615 |
| InChI Key: | YMPISWDOBJPUPL-QFIPXVFZSA-N |