1-[(4-bromophenyl)methyl]-4-{[4-(trifluoromethyl)phenyl]methyl}piperazine--oxalic acid (1/1)
Chemical Structure Depiction of
1-[(4-bromophenyl)methyl]-4-{[4-(trifluoromethyl)phenyl]methyl}piperazine--oxalic acid (1/1)
1-[(4-bromophenyl)methyl]-4-{[4-(trifluoromethyl)phenyl]methyl}piperazine--oxalic acid (1/1)
Compound characteristics
| Compound ID: | 3381-0695 |
| Compound Name: | 1-[(4-bromophenyl)methyl]-4-{[4-(trifluoromethyl)phenyl]methyl}piperazine--oxalic acid (1/1) |
| Molecular Weight: | 503.31 |
| Molecular Formula: | C19 H20 Br F3 N2 |
| Salt: | HOOCCOOH |
| Smiles: | C1CN(CCN1Cc1ccc(cc1)C(F)(F)F)Cc1ccc(cc1)[Br] |
| Stereo: | ACHIRAL |
| logP: | 4.6499 |
| logD: | 4.1887 |
| logSw: | -4.6347 |
| Hydrogen bond acceptors count: | 2 |
| Polar surface area: | 7.5114 |
| InChI Key: | RCKATCQQUOVUCF-UHFFFAOYSA-N |