3-(4-bromobenzene-1-sulfonyl)-2-(4-nitrophenyl)-1,3-thiazolidine
Chemical Structure Depiction of
3-(4-bromobenzene-1-sulfonyl)-2-(4-nitrophenyl)-1,3-thiazolidine
3-(4-bromobenzene-1-sulfonyl)-2-(4-nitrophenyl)-1,3-thiazolidine
Compound characteristics
| Compound ID: | 3382-0795 |
| Compound Name: | 3-(4-bromobenzene-1-sulfonyl)-2-(4-nitrophenyl)-1,3-thiazolidine |
| Molecular Weight: | 429.31 |
| Molecular Formula: | C15 H13 Br N2 O4 S2 |
| Smiles: | C1CSC(c2ccc(cc2)[N+]([O-])=O)N1S(c1ccc(cc1)[Br])(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.1727 |
| logD: | 4.1727 |
| logSw: | -4.2372 |
| Hydrogen bond acceptors count: | 10 |
| Polar surface area: | 65.898 |
| InChI Key: | DGWVBMHMDWKKSD-HNNXBMFYSA-N |