3-(4-chlorophenyl)-5-[3-(trifluoromethyl)phenyl]-3a,6a-dihydrospiro[furo[3,4-c]pyrrole-1,2'-indene]-1',3',4,6(3H,5H)-tetrone
Chemical Structure Depiction of
3-(4-chlorophenyl)-5-[3-(trifluoromethyl)phenyl]-3a,6a-dihydrospiro[furo[3,4-c]pyrrole-1,2'-indene]-1',3',4,6(3H,5H)-tetrone
3-(4-chlorophenyl)-5-[3-(trifluoromethyl)phenyl]-3a,6a-dihydrospiro[furo[3,4-c]pyrrole-1,2'-indene]-1',3',4,6(3H,5H)-tetrone
Compound characteristics
| Compound ID: | 3390-0067 |
| Compound Name: | 3-(4-chlorophenyl)-5-[3-(trifluoromethyl)phenyl]-3a,6a-dihydrospiro[furo[3,4-c]pyrrole-1,2'-indene]-1',3',4,6(3H,5H)-tetrone |
| Molecular Weight: | 525.87 |
| Molecular Formula: | C27 H15 Cl F3 N O5 |
| Smiles: | c1ccc2C(C3(C4C(C(c5ccc(cc5)[Cl])O3)C(N(C4=O)c3cccc(c3)C(F)(F)F)=O)C(c2c1)=O)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 4.5289 |
| logD: | 4.5289 |
| logSw: | -4.9824 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 63.735 |
| InChI Key: | YPIINWIWFSQQES-UHFFFAOYSA-N |