3-(2-chlorophenyl)-5-(2,4-dimethoxyphenyl)-3a,6a-dihydrospiro[furo[3,4-c]pyrrole-1,2'-indene]-1',3',4,6(3H,5H)-tetrone
Chemical Structure Depiction of
3-(2-chlorophenyl)-5-(2,4-dimethoxyphenyl)-3a,6a-dihydrospiro[furo[3,4-c]pyrrole-1,2'-indene]-1',3',4,6(3H,5H)-tetrone
3-(2-chlorophenyl)-5-(2,4-dimethoxyphenyl)-3a,6a-dihydrospiro[furo[3,4-c]pyrrole-1,2'-indene]-1',3',4,6(3H,5H)-tetrone
Compound characteristics
| Compound ID: | 3390-0075 |
| Compound Name: | 3-(2-chlorophenyl)-5-(2,4-dimethoxyphenyl)-3a,6a-dihydrospiro[furo[3,4-c]pyrrole-1,2'-indene]-1',3',4,6(3H,5H)-tetrone |
| Molecular Weight: | 517.92 |
| Molecular Formula: | C28 H20 Cl N O7 |
| Smiles: | COc1ccc(c(c1)OC)N1C(C2C(C1=O)C1(C(c3ccccc3C1=O)=O)OC2c1ccccc1[Cl])=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 3.6563 |
| logD: | 3.6563 |
| logSw: | -4.0713 |
| Hydrogen bond acceptors count: | 11 |
| Polar surface area: | 78.608 |
| InChI Key: | ZRWHLENYRZNAOF-UHFFFAOYSA-N |