6-amino-3-(3-nitrophenyl)-4-(2,4,5-trimethoxyphenyl)-1,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile
					Chemical Structure Depiction of
6-amino-3-(3-nitrophenyl)-4-(2,4,5-trimethoxyphenyl)-1,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile
			6-amino-3-(3-nitrophenyl)-4-(2,4,5-trimethoxyphenyl)-1,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile
Compound characteristics
| Compound ID: | 3394-0241 | 
| Compound Name: | 6-amino-3-(3-nitrophenyl)-4-(2,4,5-trimethoxyphenyl)-1,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile | 
| Molecular Weight: | 449.42 | 
| Molecular Formula: | C22 H19 N5 O6 | 
| Smiles: | COc1cc(c(cc1C1C(C#N)=C(N)Oc2c1c(c1cccc(c1)[N+]([O-])=O)n[nH]2)OC)OC | 
| Stereo: | RACEMIC MIXTURE | 
| logP: | 2.4901 | 
| logD: | 2.4901 | 
| logSw: | -2.9024 | 
| Hydrogen bond acceptors count: | 10 | 
| Hydrogen bond donors count: | 3 | 
| Polar surface area: | 126.746 | 
| InChI Key: | RCSULJBHFNOOGE-SFHVURJKSA-N | 
 
				 
				