N-(2-chlorophenyl)-2-[(4,6-dioxo-5-phenyl-1,4,5,6-tetrahydropyrimidin-2-yl)sulfanyl]acetamide
Chemical Structure Depiction of
N-(2-chlorophenyl)-2-[(4,6-dioxo-5-phenyl-1,4,5,6-tetrahydropyrimidin-2-yl)sulfanyl]acetamide
N-(2-chlorophenyl)-2-[(4,6-dioxo-5-phenyl-1,4,5,6-tetrahydropyrimidin-2-yl)sulfanyl]acetamide
Compound characteristics
| Compound ID: | 3398-0018 |
| Compound Name: | N-(2-chlorophenyl)-2-[(4,6-dioxo-5-phenyl-1,4,5,6-tetrahydropyrimidin-2-yl)sulfanyl]acetamide |
| Molecular Weight: | 387.84 |
| Molecular Formula: | C18 H14 Cl N3 O3 S |
| Smiles: | C(C(Nc1ccccc1[Cl])=O)SC1NC(C(C(N=1)=O)c1ccccc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.9309 |
| logD: | -6.1909 |
| logSw: | -2.6916 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 70.475 |
| InChI Key: | YHQPKNAPFIYFKL-UHFFFAOYSA-N |