N-[2-(2-fluorophenyl)-4-oxoquinazolin-3(4H)-yl]-3-(4-nitrophenyl)prop-2-enamide
Chemical Structure Depiction of
N-[2-(2-fluorophenyl)-4-oxoquinazolin-3(4H)-yl]-3-(4-nitrophenyl)prop-2-enamide
N-[2-(2-fluorophenyl)-4-oxoquinazolin-3(4H)-yl]-3-(4-nitrophenyl)prop-2-enamide
Compound characteristics
| Compound ID: | 3401-5523 |
| Compound Name: | N-[2-(2-fluorophenyl)-4-oxoquinazolin-3(4H)-yl]-3-(4-nitrophenyl)prop-2-enamide |
| Molecular Weight: | 430.39 |
| Molecular Formula: | C23 H15 F N4 O4 |
| Smiles: | C(=C/c1ccc(cc1)[N+]([O-])=O)\C(NN1C(c2ccccc2F)=Nc2ccccc2C1=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.3695 |
| logD: | 3.3673 |
| logSw: | -3.9776 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 84.919 |
| InChI Key: | OWDUFMFZVVVLOC-UHFFFAOYSA-N |